About but-2-enedioic acid;ethenyl acetate;styrene
but-2-enedioic acid;ethenyl acetate;styrene (PubChem CID 159833587) has the molecular formula C16H18O6
and a molecular weight of 306.31 g/mol. Its IUPAC name is but-2-enedioic acid;ethenyl acetate;styrene.
Molecular Properties
| Compound Name | but-2-enedioic acid;ethenyl acetate;styrene |
| PubChem CID | 159833587 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | but-2-enedioic acid;ethenyl acetate;styrene |
| SMILES | C=COC(C)=O.C=Cc1ccccc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C8H8.C4H4O4.C4H6O2/c1-2-8-6-4-3-5-7-8;5-3(6)1-2-4(7)8;1-3-6-4(2)5/h2-7H,1H2;1-2H,(H,5,6)(H,7,8);3H,1H2,2H3 |
| InChIKey | NNTMCTOVPJHVMT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enedioic acid;ethenyl acetate;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enedioic acid;ethenyl acetate;styrene?
The IUPAC name of but-2-enedioic acid;ethenyl acetate;styrene (CID 159833587) is but-2-enedioic acid;ethenyl acetate;styrene.
What is the SMILES notation for but-2-enedioic acid;ethenyl acetate;styrene?
The canonical SMILES for but-2-enedioic acid;ethenyl acetate;styrene is C=COC(C)=O.C=Cc1ccccc1.O=C(O)C=CC(=O)O.
What is the InChIKey of but-2-enedioic acid;ethenyl acetate;styrene?
The InChIKey is NNTMCTOVPJHVMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8.C4H4O4.C4H6O2/c1-2-8-6-4-3-5-7-8;5-3(6)1-2-4(7)8;1-3-6-4(2)5/h2-7H,1H2;1-2H,(H,5,6)(H,7,8);3H,1H2,2H3.
What are the key properties of but-2-enedioic acid;ethenyl acetate;styrene?
but-2-enedioic acid;ethenyl acetate;styrene has a molecular weight of 306.31 g/mol, XLogP of 2.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enedioic acid;ethenyl acetate;styrene is sourced from PubChem (CID 159833587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).