About acetic acid;acetyl acetate;ethenyl acetate
acetic acid;acetyl acetate;ethenyl acetate (PubChem CID 158501483) has the molecular formula C10H16O7
and a molecular weight of 248.23 g/mol. Its IUPAC name is acetic acid;acetyl acetate;ethenyl acetate.
Molecular Properties
| Compound Name | acetic acid;acetyl acetate;ethenyl acetate |
| PubChem CID | 158501483 |
| Molecular Formula | C10H16O7 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | acetic acid;acetyl acetate;ethenyl acetate |
| SMILES | C=COC(C)=O.CC(=O)O.CC(=O)OC(C)=O |
| InChI | InChI=1S/C4H6O3.C4H6O2.C2H4O2/c1-3(5)7-4(2)6;1-3-6-4(2)5;1-2(3)4/h1-2H3;3H,1H2,2H3;1H3,(H,3,4) |
| InChIKey | HJYHNCPUYWIGIJ-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;acetyl acetate;ethenyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;acetyl acetate;ethenyl acetate?
The IUPAC name of acetic acid;acetyl acetate;ethenyl acetate (CID 158501483) is acetic acid;acetyl acetate;ethenyl acetate.
What is the SMILES notation for acetic acid;acetyl acetate;ethenyl acetate?
The canonical SMILES for acetic acid;acetyl acetate;ethenyl acetate is C=COC(C)=O.CC(=O)O.CC(=O)OC(C)=O.
What is the InChIKey of acetic acid;acetyl acetate;ethenyl acetate?
The InChIKey is HJYHNCPUYWIGIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.C4H6O2.C2H4O2/c1-3(5)7-4(2)6;1-3-6-4(2)5;1-2(3)4/h1-2H3;3H,1H2,2H3;1H3,(H,3,4).
What are the key properties of acetic acid;acetyl acetate;ethenyl acetate?
acetic acid;acetyl acetate;ethenyl acetate has a molecular weight of 248.23 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;acetyl acetate;ethenyl acetate is sourced from PubChem (CID 158501483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).