About ethenyl acetate;methoxyethene
ethenyl acetate;methoxyethene (PubChem CID 18921270) has the molecular formula C7H12O3
and a molecular weight of 144.17 g/mol. Its IUPAC name is ethenyl acetate;methoxyethene.
Molecular Properties
| Compound Name | ethenyl acetate;methoxyethene |
| PubChem CID | 18921270 |
| Molecular Formula | C7H12O3 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.08 |
| IUPAC Name | ethenyl acetate;methoxyethene |
| SMILES | C=COC.C=COC(C)=O |
| InChI | InChI=1S/C4H6O2.C3H6O/c1-3-6-4(2)5;1-3-4-2/h3H,1H2,2H3;3H,1H2,2H3 |
| InChIKey | TYCLOJMOMLKEGU-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenyl acetate;methoxyethene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl acetate;methoxyethene?
The IUPAC name of ethenyl acetate;methoxyethene (CID 18921270) is ethenyl acetate;methoxyethene.
What is the SMILES notation for ethenyl acetate;methoxyethene?
The canonical SMILES for ethenyl acetate;methoxyethene is C=COC.C=COC(C)=O.
What is the InChIKey of ethenyl acetate;methoxyethene?
The InChIKey is TYCLOJMOMLKEGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C3H6O/c1-3-6-4(2)5;1-3-4-2/h3H,1H2,2H3;3H,1H2,2H3.
What are the key properties of ethenyl acetate;methoxyethene?
ethenyl acetate;methoxyethene has a molecular weight of 144.17 g/mol, XLogP of 1.47, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl acetate;methoxyethene is sourced from PubChem (CID 18921270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).