About bis((Z)-but-2-enedioic acid);ethenyl acetate
bis((Z)-but-2-enedioic acid);ethenyl acetate (PubChem CID 172778933) has the molecular formula C12H14O10
and a molecular weight of 318.23 g/mol. Its IUPAC name is bis((Z)-but-2-enedioic acid);ethenyl acetate.
Molecular Properties
| Compound Name | bis((Z)-but-2-enedioic acid);ethenyl acetate |
| PubChem CID | 172778933 |
| Molecular Formula | C12H14O10 |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | bis((Z)-but-2-enedioic acid);ethenyl acetate |
| SMILES | C=COC(C)=O.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/2C4H4O4.C4H6O2/c2*5-3(6)1-2-4(7)8;1-3-6-4(2)5/h2*1-2H,(H,5,6)(H,7,8);3H,1H2,2H3/b2*2-1-; |
| InChIKey | NZJJUKUZCVQZJH-PAMPIZDHSA-N |
| XLogP | 0.12 |
| TPSA | 175.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bis((Z)-but-2-enedioic acid);ethenyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis((Z)-but-2-enedioic acid);ethenyl acetate?
The IUPAC name of bis((Z)-but-2-enedioic acid);ethenyl acetate (CID 172778933) is bis((Z)-but-2-enedioic acid);ethenyl acetate.
What is the SMILES notation for bis((Z)-but-2-enedioic acid);ethenyl acetate?
The canonical SMILES for bis((Z)-but-2-enedioic acid);ethenyl acetate is C=COC(C)=O.O=C(O)/C=C\C(=O)O.O=C(O)/C=C\C(=O)O.
What is the InChIKey of bis((Z)-but-2-enedioic acid);ethenyl acetate?
The InChIKey is NZJJUKUZCVQZJH-PAMPIZDHSA-N. The full InChI is InChI=1S/2C4H4O4.C4H6O2/c2*5-3(6)1-2-4(7)8;1-3-6-4(2)5/h2*1-2H,(H,5,6)(H,7,8);3H,1H2,2H3/b2*2-1-;.
What are the key properties of bis((Z)-but-2-enedioic acid);ethenyl acetate?
bis((Z)-but-2-enedioic acid);ethenyl acetate has a molecular weight of 318.23 g/mol, XLogP of 0.12, 5 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis((Z)-but-2-enedioic acid);ethenyl acetate is sourced from PubChem (CID 172778933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).