About sodium;2-methylprop-2-enoate;styrene
sodium;2-methylprop-2-enoate;styrene (PubChem CID 67136540) has the molecular formula C12H13NaO2
and a molecular weight of 212.22 g/mol. Its IUPAC name is sodium;2-methylprop-2-enoate;styrene.
Molecular Properties
| Compound Name | sodium;2-methylprop-2-enoate;styrene |
| PubChem CID | 67136540 |
| Molecular Formula | C12H13NaO2 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | sodium;2-methylprop-2-enoate;styrene |
| SMILES | C=C(C)C(=O)[O-].C=Cc1ccccc1.[Na+] |
| InChI | InChI=1S/C8H8.C4H6O2.Na/c1-2-8-6-4-3-5-7-8;1-3(2)4(5)6;/h2-7H,1H2;1H2,2H3,(H,5,6);/q;;+1/p-1 |
| InChIKey | HFKVQOOAQSENTP-UHFFFAOYSA-M |
| XLogP | -1.35 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-methylprop-2-enoate;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-methylprop-2-enoate;styrene?
The IUPAC name of sodium;2-methylprop-2-enoate;styrene (CID 67136540) is sodium;2-methylprop-2-enoate;styrene.
What is the SMILES notation for sodium;2-methylprop-2-enoate;styrene?
The canonical SMILES for sodium;2-methylprop-2-enoate;styrene is C=C(C)C(=O)[O-].C=Cc1ccccc1.[Na+].
What is the InChIKey of sodium;2-methylprop-2-enoate;styrene?
The InChIKey is HFKVQOOAQSENTP-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8.C4H6O2.Na/c1-2-8-6-4-3-5-7-8;1-3(2)4(5)6;/h2-7H,1H2;1H2,2H3,(H,5,6);/q;;+1/p-1.
What are the key properties of sodium;2-methylprop-2-enoate;styrene?
sodium;2-methylprop-2-enoate;styrene has a molecular weight of 212.22 g/mol, XLogP of -1.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-methylprop-2-enoate;styrene is sourced from PubChem (CID 67136540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).