About 1-phenylethanone;styrene
1-phenylethanone;styrene (PubChem CID 19811140) has the molecular formula C16H16O
and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-phenylethanone;styrene.
Molecular Properties
| Compound Name | 1-phenylethanone;styrene |
| PubChem CID | 19811140 |
| Molecular Formula | C16H16O |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 1-phenylethanone;styrene |
| SMILES | C=Cc1ccccc1.CC(=O)c1ccccc1 |
| InChI | InChI=1S/C8H8O.C8H8/c1-7(9)8-5-3-2-4-6-8;1-2-8-6-4-3-5-7-8/h2-6H,1H3;2-7H,1H2 |
| InChIKey | FHAUUNLPXLZHTB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-phenylethanone;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylethanone;styrene?
The IUPAC name of 1-phenylethanone;styrene (CID 19811140) is 1-phenylethanone;styrene.
What is the SMILES notation for 1-phenylethanone;styrene?
The canonical SMILES for 1-phenylethanone;styrene is C=Cc1ccccc1.CC(=O)c1ccccc1.
What is the InChIKey of 1-phenylethanone;styrene?
The InChIKey is FHAUUNLPXLZHTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O.C8H8/c1-7(9)8-5-3-2-4-6-8;1-2-8-6-4-3-5-7-8/h2-6H,1H3;2-7H,1H2.
What are the key properties of 1-phenylethanone;styrene?
1-phenylethanone;styrene has a molecular weight of 224.30 g/mol, XLogP of 4.22, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylethanone;styrene is sourced from PubChem (CID 19811140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).