About lithium;prop-2-enoate;styrene
lithium;prop-2-enoate;styrene (PubChem CID 163806706) has the molecular formula C11H11LiO2
and a molecular weight of 182.15 g/mol. Its IUPAC name is lithium;prop-2-enoate;styrene.
Molecular Properties
| Compound Name | lithium;prop-2-enoate;styrene |
| PubChem CID | 163806706 |
| Molecular Formula | C11H11LiO2 |
| Molecular Weight | 182.15 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | lithium;prop-2-enoate;styrene |
| SMILES | C=CC(=O)[O-].C=Cc1ccccc1.[Li+] |
| InChI | InChI=1S/C8H8.C3H4O2.Li/c1-2-8-6-4-3-5-7-8;1-2-3(4)5;/h2-7H,1H2;2H,1H2,(H,4,5);/q;;+1/p-1 |
| InChIKey | NJQJHWHQNFLKKB-UHFFFAOYSA-M |
| XLogP | -1.74 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.15 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze lithium;prop-2-enoate;styrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;prop-2-enoate;styrene?
The IUPAC name of lithium;prop-2-enoate;styrene (CID 163806706) is lithium;prop-2-enoate;styrene.
What is the SMILES notation for lithium;prop-2-enoate;styrene?
The canonical SMILES for lithium;prop-2-enoate;styrene is C=CC(=O)[O-].C=Cc1ccccc1.[Li+].
What is the InChIKey of lithium;prop-2-enoate;styrene?
The InChIKey is NJQJHWHQNFLKKB-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H8.C3H4O2.Li/c1-2-8-6-4-3-5-7-8;1-2-3(4)5;/h2-7H,1H2;2H,1H2,(H,4,5);/q;;+1/p-1.
What are the key properties of lithium;prop-2-enoate;styrene?
lithium;prop-2-enoate;styrene has a molecular weight of 182.15 g/mol, XLogP of -1.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;prop-2-enoate;styrene is sourced from PubChem (CID 163806706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).