C18H20CaO4 — CID 161431336
calcium;1,2-bis(ethenyl)benzene;bis(2-methylprop-2-enoate) (PubChem CID 161431336) has the molecular formula C18H20CaO4 and a molecular weight of 340.43 g/mol. Its IUPAC name is calcium;1,2-bis(ethenyl)benzene;bis(2-methylprop-2-enoate).
| Compound Name | calcium;1,2-bis(ethenyl)benzene;bis(2-methylprop-2-enoate) |
|---|---|
| PubChem CID | 161431336 |
| Molecular Formula | C18H20CaO4 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | calcium;1,2-bis(ethenyl)benzene;bis(2-methylprop-2-enoate) |
| SMILES | C=C(C)C(=O)[O-].C=C(C)C(=O)[O-].C=Cc1ccccc1C=C.[Ca+2] |
| InChI | InChI=1S/C10H10.2C4H6O2.Ca/c1-3-9-7-5-6-8-10(9)4-2;2*1-3(2)4(5)6;/h3-8H,1-2H2;2*1H2,2H3,(H,5,6);/q;;;+2/p-2 |
| InChIKey | VYAYRYHTAYIMJN-UHFFFAOYSA-L |
| XLogP | 1.22 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|