C10H10Pt — CID 175428021
1,2-bis(ethenyl)benzene;platinum (PubChem CID 175428021) has the molecular formula C10H10Pt and a molecular weight of 325.27 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;platinum.
| Compound Name | 1,2-bis(ethenyl)benzene;platinum |
|---|---|
| PubChem CID | 175428021 |
| Molecular Formula | C10H10Pt |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;platinum |
| SMILES | C=Cc1ccccc1C=C.[Pt] |
| InChI | InChI=1S/C10H10.Pt/c1-3-9-7-5-6-8-10(9)4-2;/h3-8H,1-2H2; |
| InChIKey | QMUWLOCLHHPPDS-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |