C18H28O2 — CID 162247147
1,2-bis(ethenyl)benzene;2-tert-butylperoxy-2-methylpropane (PubChem CID 162247147) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1,2-bis(ethenyl)benzene;2-tert-butylperoxy-2-methylpropane.
| Compound Name | 1,2-bis(ethenyl)benzene;2-tert-butylperoxy-2-methylpropane |
|---|---|
| PubChem CID | 162247147 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 1,2-bis(ethenyl)benzene;2-tert-butylperoxy-2-methylpropane |
| SMILES | C=Cc1ccccc1C=C.CC(C)(C)OOC(C)(C)C |
| InChI | InChI=1S/C10H10.C8H18O2/c1-3-9-7-5-6-8-10(9)4-2;1-7(2,3)9-10-8(4,5)6/h3-8H,1-2H2;1-6H3 |
| InChIKey | ZXMKAISHOCCLJN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|