About ditert-butyl (2-ethenylphenyl) phosphate
ditert-butyl (2-ethenylphenyl) phosphate (PubChem CID 54262154) has the molecular formula C16H25O4P
and a molecular weight of 312.35 g/mol. Its IUPAC name is ditert-butyl (2-ethenylphenyl) phosphate.
Molecular Properties
| Compound Name | ditert-butyl (2-ethenylphenyl) phosphate |
| PubChem CID | 54262154 |
| Molecular Formula | C16H25O4P |
| Molecular Weight | 312.35 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | ditert-butyl (2-ethenylphenyl) phosphate |
| SMILES | C=Cc1ccccc1OP(=O)(OC(C)(C)C)OC(C)(C)C |
| InChI | InChI=1S/C16H25O4P/c1-8-13-11-9-10-12-14(13)18-21(17,19-15(2,3)4)20-16(5,6)7/h8-12H,1H2,2-7H3 |
| InChIKey | REGJNSYTCUSKJQ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.35 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl (2-ethenylphenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl (2-ethenylphenyl) phosphate?
The IUPAC name of ditert-butyl (2-ethenylphenyl) phosphate (CID 54262154) is ditert-butyl (2-ethenylphenyl) phosphate.
What is the SMILES notation for ditert-butyl (2-ethenylphenyl) phosphate?
The canonical SMILES for ditert-butyl (2-ethenylphenyl) phosphate is C=Cc1ccccc1OP(=O)(OC(C)(C)C)OC(C)(C)C.
What is the InChIKey of ditert-butyl (2-ethenylphenyl) phosphate?
The InChIKey is REGJNSYTCUSKJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25O4P/c1-8-13-11-9-10-12-14(13)18-21(17,19-15(2,3)4)20-16(5,6)7/h8-12H,1H2,2-7H3.
What are the key properties of ditert-butyl (2-ethenylphenyl) phosphate?
ditert-butyl (2-ethenylphenyl) phosphate has a molecular weight of 312.35 g/mol, XLogP of 5.45, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl (2-ethenylphenyl) phosphate is sourced from PubChem (CID 54262154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).