About benzene;(2-ethenylphenyl) acetate
benzene;(2-ethenylphenyl) acetate (PubChem CID 175577038) has the molecular formula C16H16O2
and a molecular weight of 240.30 g/mol. Its IUPAC name is benzene;(2-ethenylphenyl) acetate.
Molecular Properties
| Compound Name | benzene;(2-ethenylphenyl) acetate |
| PubChem CID | 175577038 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | benzene;(2-ethenylphenyl) acetate |
| SMILES | C=Cc1ccccc1OC(C)=O.c1ccccc1 |
| InChI | InChI=1S/C10H10O2.C6H6/c1-3-9-6-4-5-7-10(9)12-8(2)11;1-2-4-6-5-3-1/h3-7H,1H2,2H3;1-6H |
| InChIKey | YCFYAFRNNVDFSU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze benzene;(2-ethenylphenyl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;(2-ethenylphenyl) acetate?
The IUPAC name of benzene;(2-ethenylphenyl) acetate (CID 175577038) is benzene;(2-ethenylphenyl) acetate.
What is the SMILES notation for benzene;(2-ethenylphenyl) acetate?
The canonical SMILES for benzene;(2-ethenylphenyl) acetate is C=Cc1ccccc1OC(C)=O.c1ccccc1.
What is the InChIKey of benzene;(2-ethenylphenyl) acetate?
The InChIKey is YCFYAFRNNVDFSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2.C6H6/c1-3-9-6-4-5-7-10(9)12-8(2)11;1-2-4-6-5-3-1/h3-7H,1H2,2H3;1-6H.
What are the key properties of benzene;(2-ethenylphenyl) acetate?
benzene;(2-ethenylphenyl) acetate has a molecular weight of 240.30 g/mol, XLogP of 3.94, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;(2-ethenylphenyl) acetate is sourced from PubChem (CID 175577038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).