About benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid
benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid (PubChem CID 174842663) has the molecular formula C22H23O5P
and a molecular weight of 398.40 g/mol. Its IUPAC name is benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid.
Molecular Properties
| Compound Name | benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid |
| PubChem CID | 174842663 |
| Molecular Formula | C22H23O5P |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid |
| SMILES | C=Cc1ccccc1Oc1ccccc1C=C.O=P(O)(O)O.c1ccccc1 |
| InChI | InChI=1S/C16H14O.C6H6.H3O4P/c1-3-13-9-5-7-11-15(13)17-16-12-8-6-10-14(16)4-2;1-2-4-6-5-3-1;1-5(2,3)4/h3-12H,1-2H2;1-6H;(H3,1,2,3,4) |
| InChIKey | CZJWTPJHQUVQGN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid?
The IUPAC name of benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid (CID 174842663) is benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid.
What is the SMILES notation for benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid?
The canonical SMILES for benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid is C=Cc1ccccc1Oc1ccccc1C=C.O=P(O)(O)O.c1ccccc1.
What is the InChIKey of benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid?
The InChIKey is CZJWTPJHQUVQGN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O.C6H6.H3O4P/c1-3-13-9-5-7-11-15(13)17-16-12-8-6-10-14(16)4-2;1-2-4-6-5-3-1;1-5(2,3)4/h3-12H,1-2H2;1-6H;(H3,1,2,3,4).
What are the key properties of benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid?
benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid has a molecular weight of 398.40 g/mol, XLogP of 5.52, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;1-ethenyl-2-(2-ethenylphenoxy)benzene;phosphoric acid is sourced from PubChem (CID 174842663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).