C22H25O5P — CID 174902871
1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid (PubChem CID 174902871) has the molecular formula C22H25O5P and a molecular weight of 400.41 g/mol. Its IUPAC name is 1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid.
| Compound Name | 1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid |
|---|---|
| PubChem CID | 174902871 |
| Molecular Formula | C22H25O5P |
| Molecular Weight | 400.41 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid |
| SMILES | C=Cc1ccccc1CC.O=P(O)(O)O.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C10H12.H3O4P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-9-7-5-6-8-10(9)4-2;1-5(2,3)4/h1-10H;3,5-8H,1,4H2,2H3;(H3,1,2,3,4) |
| InChIKey | ZWQUAYYLMUEWOT-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.41 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|