1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid

C22H25O5P — CID 174902871

IUPAC1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid
SMILESC=Cc1ccccc1CC.O=P(O)(O)O.c1ccc(Oc2ccccc2)cc1
InChIInChI=1S/C12H10O.C10H12.H3O4P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-9-7-5-6-8-10(9)4-2;1-5(2,3)4/h1-10H;3,5-8H,1,4H2,2H3;(H3,1,2,3,4)
InChIKeyZWQUAYYLMUEWOT-UHFFFAOYSA-N
MW400.41 g/mol
LogP5.44
Rot. Bonds4

About 1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid

1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid (PubChem CID 174902871) has the molecular formula C22H25O5P and a molecular weight of 400.41 g/mol. Its IUPAC name is 1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid.

Molecular Properties

Compound Name1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid
PubChem CID174902871
Molecular FormulaC22H25O5P
Molecular Weight400.41 g/mol
Exact Mass400.14
IUPAC Name1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid
SMILESC=Cc1ccccc1CC.O=P(O)(O)O.c1ccc(Oc2ccccc2)cc1
InChIInChI=1S/C12H10O.C10H12.H3O4P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-9-7-5-6-8-10(9)4-2;1-5(2,3)4/h1-10H;3,5-8H,1,4H2,2H3;(H3,1,2,3,4)
InChIKeyZWQUAYYLMUEWOT-UHFFFAOYSA-N
XLogP5.44
TPSA86.99 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms28
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500400.41
LogP ≤ 55.44
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid?
The IUPAC name of 1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid (CID 174902871) is 1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid.
What is the SMILES notation for 1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid?
The canonical SMILES for 1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid is C=Cc1ccccc1CC.O=P(O)(O)O.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid?
The InChIKey is ZWQUAYYLMUEWOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.C10H12.H3O4P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-9-7-5-6-8-10(9)4-2;1-5(2,3)4/h1-10H;3,5-8H,1,4H2,2H3;(H3,1,2,3,4).
What are the key properties of 1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid?
1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid has a molecular weight of 400.41 g/mol, XLogP of 5.44, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-2-ethylbenzene;phenoxybenzene;phosphoric acid is sourced from PubChem (CID 174902871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).