C14H19O7P — CID 175293363
ethane-1,2-diol;phenoxybenzene;phosphoric acid (PubChem CID 175293363) has the molecular formula C14H19O7P and a molecular weight of 330.27 g/mol. Its IUPAC name is ethane-1,2-diol;phenoxybenzene;phosphoric acid.
| Compound Name | ethane-1,2-diol;phenoxybenzene;phosphoric acid |
|---|---|
| PubChem CID | 175293363 |
| Molecular Formula | C14H19O7P |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | ethane-1,2-diol;phenoxybenzene;phosphoric acid |
| SMILES | O=P(O)(O)O.OCCO.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.C2H6O2.H3O4P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;3-1-2-4;1-5(2,3)4/h1-10H;3-4H,1-2H2;(H3,1,2,3,4) |
| InChIKey | BUUCVWGDNLIAHP-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 127.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|