About hydroxy(oxo)phosphanium;phenoxybenzene
hydroxy(oxo)phosphanium;phenoxybenzene (PubChem CID 162014005) has the molecular formula C12H12O3P+
and a molecular weight of 235.20 g/mol. Its IUPAC name is hydroxy(oxo)phosphanium;phenoxybenzene.
Molecular Properties
| Compound Name | hydroxy(oxo)phosphanium;phenoxybenzene |
| PubChem CID | 162014005 |
| Molecular Formula | C12H12O3P+ |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | hydroxy(oxo)phosphanium;phenoxybenzene |
| SMILES | O=[PH+]O.c1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C12H10O.HO2P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-2/h1-10H;3H/p+1 |
| InChIKey | HQRRBHAQQSXYAF-UHFFFAOYSA-O |
| XLogP | 3.40 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy(oxo)phosphanium;phenoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy(oxo)phosphanium;phenoxybenzene?
The IUPAC name of hydroxy(oxo)phosphanium;phenoxybenzene (CID 162014005) is hydroxy(oxo)phosphanium;phenoxybenzene.
What is the SMILES notation for hydroxy(oxo)phosphanium;phenoxybenzene?
The canonical SMILES for hydroxy(oxo)phosphanium;phenoxybenzene is O=[PH+]O.c1ccc(Oc2ccccc2)cc1.
What is the InChIKey of hydroxy(oxo)phosphanium;phenoxybenzene?
The InChIKey is HQRRBHAQQSXYAF-UHFFFAOYSA-O. The full InChI is InChI=1S/C12H10O.HO2P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-2/h1-10H;3H/p+1.
What are the key properties of hydroxy(oxo)phosphanium;phenoxybenzene?
hydroxy(oxo)phosphanium;phenoxybenzene has a molecular weight of 235.20 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy(oxo)phosphanium;phenoxybenzene is sourced from PubChem (CID 162014005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).