C60H42O9 — CID 167430627
1,3,5-tris[4-(4-phenoxyphenoxy)phenoxy]benzene (PubChem CID 167430627) has the molecular formula C60H42O9 and a molecular weight of 906.99 g/mol. Its IUPAC name is 1,3,5-tris[4-(4-phenoxyphenoxy)phenoxy]benzene.
| Compound Name | 1,3,5-tris[4-(4-phenoxyphenoxy)phenoxy]benzene |
|---|---|
| PubChem CID | 167430627 |
| Molecular Formula | C60H42O9 |
| Molecular Weight | 906.99 g/mol |
| Exact Mass | 906.28 |
| IUPAC Name | 1,3,5-tris[4-(4-phenoxyphenoxy)phenoxy]benzene |
| SMILES | c1ccc(Oc2ccc(Oc3ccc(Oc4cc(Oc5ccc(Oc6ccc(Oc7ccccc7)cc6)cc5)cc(Oc5ccc(Oc6ccc(Oc7ccccc7)cc6)cc5)c4)cc3)cc2)cc1 |
| InChI | InChI=1S/C60H42O9/c1-4-10-43(11-5-1)61-46-16-22-49(23-17-46)64-52-28-34-55(35-29-52)67-58-40-59(68-56-36-30-53(31-37-56)65-50-24-18-47(19-25-50)62-44-12-6-2-7-13-44)42-60(41-58)69-57-38-32-54(33-39-57)66-51-26-20-48(21-27-51)63-45-14-8-3-9-15-45/h1-42H |
| InChIKey | RLLHLFMPJNQWDT-UHFFFAOYSA-N |
| XLogP | 17.82 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 906.99 |
| LogP ≤ 5 | 17.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |