About 5-phenoxybenzene-1,3-dicarbonitrile
5-phenoxybenzene-1,3-dicarbonitrile (PubChem CID 76539682) has the molecular formula C14H8N2O
and a molecular weight of 220.23 g/mol. Its IUPAC name is 5-phenoxybenzene-1,3-dicarbonitrile.
Molecular Properties
| Compound Name | 5-phenoxybenzene-1,3-dicarbonitrile |
| PubChem CID | 76539682 |
| Molecular Formula | C14H8N2O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | 5-phenoxybenzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)cc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C14H8N2O/c15-9-11-6-12(10-16)8-14(7-11)17-13-4-2-1-3-5-13/h1-8H |
| InChIKey | OAFZHBMHLQJMIN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-phenoxybenzene-1,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenoxybenzene-1,3-dicarbonitrile?
The IUPAC name of 5-phenoxybenzene-1,3-dicarbonitrile (CID 76539682) is 5-phenoxybenzene-1,3-dicarbonitrile.
What is the SMILES notation for 5-phenoxybenzene-1,3-dicarbonitrile?
The canonical SMILES for 5-phenoxybenzene-1,3-dicarbonitrile is N#Cc1cc(C#N)cc(Oc2ccccc2)c1.
What is the InChIKey of 5-phenoxybenzene-1,3-dicarbonitrile?
The InChIKey is OAFZHBMHLQJMIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2O/c15-9-11-6-12(10-16)8-14(7-11)17-13-4-2-1-3-5-13/h1-8H.
What are the key properties of 5-phenoxybenzene-1,3-dicarbonitrile?
5-phenoxybenzene-1,3-dicarbonitrile has a molecular weight of 220.23 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenoxybenzene-1,3-dicarbonitrile is sourced from PubChem (CID 76539682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).