C20H12N2O2 — CID 680327
4,5-diphenoxybenzene-1,2-dicarbonitrile (PubChem CID 680327) has the molecular formula C20H12N2O2 and a molecular weight of 312.33 g/mol. Its IUPAC name is 4,5-diphenoxybenzene-1,2-dicarbonitrile.
| Compound Name | 4,5-diphenoxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 680327 |
| Molecular Formula | C20H12N2O2 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | 4,5-diphenoxybenzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cc(Oc2ccccc2)c(Oc2ccccc2)cc1C#N |
| InChI | InChI=1S/C20H12N2O2/c21-13-15-11-19(23-17-7-3-1-4-8-17)20(12-16(15)14-22)24-18-9-5-2-6-10-18/h1-12H |
| InChIKey | WLHHJDXXVXXPPI-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |