C19H13NO2 — CID 71353957
2,6-diphenoxybenzonitrile (PubChem CID 71353957) has the molecular formula C19H13NO2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 2,6-diphenoxybenzonitrile.
| Compound Name | 2,6-diphenoxybenzonitrile |
|---|---|
| PubChem CID | 71353957 |
| Molecular Formula | C19H13NO2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 2,6-diphenoxybenzonitrile |
| SMILES | N#Cc1c(Oc2ccccc2)cccc1Oc1ccccc1 |
| InChI | InChI=1S/C19H13NO2/c20-14-17-18(21-15-8-3-1-4-9-15)12-7-13-19(17)22-16-10-5-2-6-11-16/h1-13H |
| InChIKey | WNIXQRKSGAVKHJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |