C22H10N4O2 — CID 19922197
3-[2-(2,3-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 19922197) has the molecular formula C22H10N4O2 and a molecular weight of 362.35 g/mol. Its IUPAC name is 3-[2-(2,3-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 3-[2-(2,3-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 19922197 |
| Molecular Formula | C22H10N4O2 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | 3-[2-(2,3-dicyanophenoxy)phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cccc(Oc2ccccc2Oc2cccc(C#N)c2C#N)c1C#N |
| InChI | InChI=1S/C22H10N4O2/c23-11-15-5-3-9-19(17(15)13-25)27-21-7-1-2-8-22(21)28-20-10-4-6-16(12-24)18(20)14-26/h1-10H |
| InChIKey | OLKUXRYYECYUFC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |