C14H7FN2O — CID 19895093
3-(3-fluorophenoxy)benzene-1,2-dicarbonitrile (PubChem CID 19895093) has the molecular formula C14H7FN2O and a molecular weight of 238.22 g/mol. Its IUPAC name is 3-(3-fluorophenoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 3-(3-fluorophenoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 19895093 |
| Molecular Formula | C14H7FN2O |
| Molecular Weight | 238.22 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 3-(3-fluorophenoxy)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cccc(Oc2cccc(F)c2)c1C#N |
| InChI | InChI=1S/C14H7FN2O/c15-11-4-2-5-12(7-11)18-14-6-1-3-10(8-16)13(14)9-17/h1-7H |
| InChIKey | NSYLJWWDKIBMNA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.22 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |