C16H12N2O — CID 68696975
3-(3,5-dimethylphenoxy)benzene-1,2-dicarbonitrile (PubChem CID 68696975) has the molecular formula C16H12N2O and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-(3,5-dimethylphenoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 3-(3,5-dimethylphenoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 68696975 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 3-(3,5-dimethylphenoxy)benzene-1,2-dicarbonitrile |
| SMILES | Cc1cc(C)cc(Oc2cccc(C#N)c2C#N)c1 |
| InChI | InChI=1S/C16H12N2O/c1-11-6-12(2)8-14(7-11)19-16-5-3-4-13(9-17)15(16)10-18/h3-8H,1-2H3 |
| InChIKey | NFESPLUCWRQSFN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |