C16H12N2O3 — CID 141490730
3-[4-(2-hydroxyethoxy)phenoxy]benzene-1,2-dicarbonitrile (PubChem CID 141490730) has the molecular formula C16H12N2O3 and a molecular weight of 280.28 g/mol. Its IUPAC name is 3-[4-(2-hydroxyethoxy)phenoxy]benzene-1,2-dicarbonitrile.
| Compound Name | 3-[4-(2-hydroxyethoxy)phenoxy]benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 141490730 |
| Molecular Formula | C16H12N2O3 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 3-[4-(2-hydroxyethoxy)phenoxy]benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cccc(Oc2ccc(OCCO)cc2)c1C#N |
| InChI | InChI=1S/C16H12N2O3/c17-10-12-2-1-3-16(15(12)11-18)21-14-6-4-13(5-7-14)20-9-8-19/h1-7,19H,8-9H2 |
| InChIKey | XDHAWXSVXICOQY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |