C12H12N2O — CID 18469841
3-butoxybenzene-1,2-dicarbonitrile (PubChem CID 18469841) has the molecular formula C12H12N2O and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-butoxybenzene-1,2-dicarbonitrile.
| Compound Name | 3-butoxybenzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 18469841 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 3-butoxybenzene-1,2-dicarbonitrile |
| SMILES | CCCCOc1cccc(C#N)c1C#N |
| InChI | InChI=1S/C12H12N2O/c1-2-3-7-15-12-6-4-5-10(8-13)11(12)9-14/h4-6H,2-3,7H2,1H3 |
| InChIKey | IOYBLYAUPGRGAS-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|