C18H16N2O2 — CID 21014626
3-(3-phenylmethoxypropoxy)benzene-1,2-dicarbonitrile (PubChem CID 21014626) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 3-(3-phenylmethoxypropoxy)benzene-1,2-dicarbonitrile.
| Compound Name | 3-(3-phenylmethoxypropoxy)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 21014626 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 3-(3-phenylmethoxypropoxy)benzene-1,2-dicarbonitrile |
| SMILES | N#Cc1cccc(OCCCOCc2ccccc2)c1C#N |
| InChI | InChI=1S/C18H16N2O2/c19-12-16-8-4-9-18(17(16)13-20)22-11-5-10-21-14-15-6-2-1-3-7-15/h1-4,6-9H,5,10-11,14H2 |
| InChIKey | MGAJZTQDZMKGAZ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|