C19H23NO2 — CID 102193876
1,4-dibutoxynaphthalene-2-carbonitrile (PubChem CID 102193876) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is 1,4-dibutoxynaphthalene-2-carbonitrile.
| Compound Name | 1,4-dibutoxynaphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 102193876 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | 1,4-dibutoxynaphthalene-2-carbonitrile |
| SMILES | CCCCOc1cc(C#N)c(OCCCC)c2ccccc12 |
| InChI | InChI=1S/C19H23NO2/c1-3-5-11-21-18-13-15(14-20)19(22-12-6-4-2)17-10-8-7-9-16(17)18/h7-10,13H,3-6,11-12H2,1-2H3 |
| InChIKey | YIKFAZKKOFMWTO-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|