C24H30N2O2 — CID 10667387
1,5-dihexoxynaphthalene-2,6-dicarbonitrile (PubChem CID 10667387) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 1,5-dihexoxynaphthalene-2,6-dicarbonitrile.
| Compound Name | 1,5-dihexoxynaphthalene-2,6-dicarbonitrile |
|---|---|
| PubChem CID | 10667387 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 1,5-dihexoxynaphthalene-2,6-dicarbonitrile |
| SMILES | CCCCCCOc1c(C#N)ccc2c(OCCCCCC)c(C#N)ccc12 |
| InChI | InChI=1S/C24H30N2O2/c1-3-5-7-9-15-27-23-19(17-25)11-14-22-21(23)13-12-20(18-26)24(22)28-16-10-8-6-4-2/h11-14H,3-10,15-16H2,1-2H3 |
| InChIKey | JPTFXCRSCWXZJO-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|