About 4-decoxybenzonitrile
4-decoxybenzonitrile (PubChem CID 19021371) has the molecular formula C17H25NO
and a molecular weight of 259.39 g/mol. Its IUPAC name is 4-decoxybenzonitrile.
Molecular Properties
| Compound Name | 4-decoxybenzonitrile |
| PubChem CID | 19021371 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 4-decoxybenzonitrile |
| SMILES | CCCCCCCCCCOc1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H25NO/c1-2-3-4-5-6-7-8-9-14-19-17-12-10-16(15-18)11-13-17/h10-13H,2-9,14H2,1H3 |
| InChIKey | SNZPHYPGLGYDBO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-decoxybenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-decoxybenzonitrile?
The IUPAC name of 4-decoxybenzonitrile (CID 19021371) is 4-decoxybenzonitrile.
What is the SMILES notation for 4-decoxybenzonitrile?
The canonical SMILES for 4-decoxybenzonitrile is CCCCCCCCCCOc1ccc(C#N)cc1.
What is the InChIKey of 4-decoxybenzonitrile?
The InChIKey is SNZPHYPGLGYDBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO/c1-2-3-4-5-6-7-8-9-14-19-17-12-10-16(15-18)11-13-17/h10-13H,2-9,14H2,1H3.
What are the key properties of 4-decoxybenzonitrile?
4-decoxybenzonitrile has a molecular weight of 259.39 g/mol, XLogP of 5.08, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-decoxybenzonitrile is sourced from PubChem (CID 19021371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).