About 4-hexoxybenzonitrile;4-hexoxy-N-methylaniline
4-hexoxybenzonitrile;4-hexoxy-N-methylaniline (PubChem CID 174889691) has the molecular formula C26H38N2O2
and a molecular weight of 410.60 g/mol. Its IUPAC name is 4-hexoxybenzonitrile;4-hexoxy-N-methylaniline.
Molecular Properties
| Compound Name | 4-hexoxybenzonitrile;4-hexoxy-N-methylaniline |
| PubChem CID | 174889691 |
| Molecular Formula | C26H38N2O2 |
| Molecular Weight | 410.60 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | 4-hexoxybenzonitrile;4-hexoxy-N-methylaniline |
| SMILES | CCCCCCOc1ccc(C#N)cc1.CCCCCCOc1ccc(NC)cc1 |
| InChI | InChI=1S/C13H21NO.C13H17NO/c1-3-4-5-6-11-15-13-9-7-12(14-2)8-10-13;1-2-3-4-5-10-15-13-8-6-12(11-14)7-9-13/h7-10,14H,3-6,11H2,1-2H3;6-9H,2-5,10H2,1H3 |
| InChIKey | WCVVYGVRYCRHLW-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.60 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-hexoxybenzonitrile;4-hexoxy-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hexoxybenzonitrile;4-hexoxy-N-methylaniline?
The IUPAC name of 4-hexoxybenzonitrile;4-hexoxy-N-methylaniline (CID 174889691) is 4-hexoxybenzonitrile;4-hexoxy-N-methylaniline.
What is the SMILES notation for 4-hexoxybenzonitrile;4-hexoxy-N-methylaniline?
The canonical SMILES for 4-hexoxybenzonitrile;4-hexoxy-N-methylaniline is CCCCCCOc1ccc(C#N)cc1.CCCCCCOc1ccc(NC)cc1.
What is the InChIKey of 4-hexoxybenzonitrile;4-hexoxy-N-methylaniline?
The InChIKey is WCVVYGVRYCRHLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21NO.C13H17NO/c1-3-4-5-6-11-15-13-9-7-12(14-2)8-10-13;1-2-3-4-5-10-15-13-8-6-12(11-14)7-9-13/h7-10,14H,3-6,11H2,1-2H3;6-9H,2-5,10H2,1H3.
What are the key properties of 4-hexoxybenzonitrile;4-hexoxy-N-methylaniline?
4-hexoxybenzonitrile;4-hexoxy-N-methylaniline has a molecular weight of 410.60 g/mol, XLogP of 7.20, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hexoxybenzonitrile;4-hexoxy-N-methylaniline is sourced from PubChem (CID 174889691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).