C26H36O4 — CID 102384866
1,5-diheptoxynaphthalene-2,6-dicarbaldehyde (PubChem CID 102384866) has the molecular formula C26H36O4 and a molecular weight of 412.57 g/mol. Its IUPAC name is 1,5-diheptoxynaphthalene-2,6-dicarbaldehyde.
| Compound Name | 1,5-diheptoxynaphthalene-2,6-dicarbaldehyde |
|---|---|
| PubChem CID | 102384866 |
| Molecular Formula | C26H36O4 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.26 |
| IUPAC Name | 1,5-diheptoxynaphthalene-2,6-dicarbaldehyde |
| SMILES | CCCCCCCOc1c(C=O)ccc2c(OCCCCCCC)c(C=O)ccc12 |
| InChI | InChI=1S/C26H36O4/c1-3-5-7-9-11-17-29-25-21(19-27)13-16-24-23(25)15-14-22(20-28)26(24)30-18-12-10-8-6-4-2/h13-16,19-20H,3-12,17-18H2,1-2H3 |
| InChIKey | LGPLTHSJKCVYQM-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|