C40H42F6O6S2 — CID 102067146
1,5-dihexoxy-2,6-bis[(Z)-2-phenyl-2-(trifluoromethylsulfonyl)ethenyl]naphthalene (PubChem CID 102067146) has the molecular formula C40H42F6O6S2 and a molecular weight of 796.89 g/mol. Its IUPAC name is 1,5-dihexoxy-2,6-bis[(Z)-2-phenyl-2-(trifluoromethylsulfonyl)ethenyl]naphthalene.
| Compound Name | 1,5-dihexoxy-2,6-bis[(Z)-2-phenyl-2-(trifluoromethylsulfonyl)ethenyl]naphthalene |
|---|---|
| PubChem CID | 102067146 |
| Molecular Formula | C40H42F6O6S2 |
| Molecular Weight | 796.89 g/mol |
| Exact Mass | 796.23 |
| IUPAC Name | 1,5-dihexoxy-2,6-bis[(Z)-2-phenyl-2-(trifluoromethylsulfonyl)ethenyl]naphthalene |
| SMILES | CCCCCCOc1c(/C=C(/c2ccccc2)S(=O)(=O)C(F)(F)F)ccc2c(OCCCCCC)c(/C=C(/c3ccccc3)S(=O)(=O)C(F)(F)F)ccc12 |
| InChI | InChI=1S/C40H42F6O6S2/c1-3-5-7-15-25-51-37-31(27-35(29-17-11-9-12-18-29)53(47,48)39(41,42)43)21-24-34-33(37)23-22-32(38(34)52-26-16-8-6-4-2)28-36(30-19-13-10-14-20-30)54(49,50)40(44,45)46/h9-14,17-24,27-28H,3-8,15-16,25-26H2,1-2H3/b35-27-,36-28- |
| InChIKey | AZQANIIRTWATBQ-FWQLXOFSSA-N |
| XLogP | 11.62 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.89 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|