C23H32F3O4PS — CID 162622791
(4-decoxyphenyl)-phenylphosphane;trifluoromethanesulfonic acid (PubChem CID 162622791) has the molecular formula C23H32F3O4PS and a molecular weight of 492.54 g/mol. Its IUPAC name is (4-decoxyphenyl)-phenylphosphane;trifluoromethanesulfonic acid.
| Compound Name | (4-decoxyphenyl)-phenylphosphane;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 162622791 |
| Molecular Formula | C23H32F3O4PS |
| Molecular Weight | 492.54 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | (4-decoxyphenyl)-phenylphosphane;trifluoromethanesulfonic acid |
| SMILES | CCCCCCCCCCOc1ccc(Pc2ccccc2)cc1.O=S(=O)(O)C(F)(F)F |
| InChI | InChI=1S/C22H31OP.CHF3O3S/c1-2-3-4-5-6-7-8-12-19-23-20-15-17-22(18-16-20)24-21-13-10-9-11-14-21;2-1(3,4)8(5,6)7/h9-11,13-18,24H,2-8,12,19H2,1H3;(H,5,6,7) |
| InChIKey | UKQUSAQQZPHKQY-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.54 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|