C20H28O3 — CID 174756360
1,4-dibutoxybenzene;phenol (PubChem CID 174756360) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is 1,4-dibutoxybenzene;phenol.
| Compound Name | 1,4-dibutoxybenzene;phenol |
|---|---|
| PubChem CID | 174756360 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 1,4-dibutoxybenzene;phenol |
| SMILES | CCCCOc1ccc(OCCCC)cc1.Oc1ccccc1 |
| InChI | InChI=1S/C14H22O2.C6H6O/c1-3-5-11-15-13-7-9-14(10-8-13)16-12-6-4-2;7-6-4-2-1-3-5-6/h7-10H,3-6,11-12H2,1-2H3;1-5,7H |
| InChIKey | BSLZJANKTAIBGW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|