C21H30O2 — CID 161478542
4-tert-butylphenol;pentoxybenzene (PubChem CID 161478542) has the molecular formula C21H30O2 and a molecular weight of 314.47 g/mol. Its IUPAC name is 4-tert-butylphenol;pentoxybenzene.
| Compound Name | 4-tert-butylphenol;pentoxybenzene |
|---|---|
| PubChem CID | 161478542 |
| Molecular Formula | C21H30O2 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 4-tert-butylphenol;pentoxybenzene |
| SMILES | CC(C)(C)c1ccc(O)cc1.CCCCCOc1ccccc1 |
| InChI | InChI=1S/C11H16O.C10H14O/c1-2-3-7-10-12-11-8-5-4-6-9-11;1-10(2,3)8-4-6-9(11)7-5-8/h4-6,8-9H,2-3,7,10H2,1H3;4-7,11H,1-3H3 |
| InChIKey | WEAUBAUUSCIOLH-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|