C76H90O4 — CID 15189872
4-[[4-[10-[4-[bis(4-tert-butylphenyl)-(4-hydroxyphenyl)methyl]phenoxy]decoxy]phenyl]-bis(4-tert-butylphenyl)methyl]phenol (PubChem CID 15189872) has the molecular formula C76H90O4 and a molecular weight of 1067.55 g/mol. Its IUPAC name is 4-[[4-[10-[4-[bis(4-tert-butylphenyl)-(4-hydroxyphenyl)methyl]phenoxy]decoxy]phenyl]-bis(4-tert-butylphenyl)methyl]phenol.
| Compound Name | 4-[[4-[10-[4-[bis(4-tert-butylphenyl)-(4-hydroxyphenyl)methyl]phenoxy]decoxy]phenyl]-bis(4-tert-butylphenyl)methyl]phenol |
|---|---|
| PubChem CID | 15189872 |
| Molecular Formula | C76H90O4 |
| Molecular Weight | 1067.55 g/mol |
| Exact Mass | 1066.68 |
| IUPAC Name | 4-[[4-[10-[4-[bis(4-tert-butylphenyl)-(4-hydroxyphenyl)methyl]phenoxy]decoxy]phenyl]-bis(4-tert-butylphenyl)methyl]phenol |
| SMILES | CC(C)(C)c1ccc(C(c2ccc(O)cc2)(c2ccc(OCCCCCCCCCCOc3ccc(C(c4ccc(O)cc4)(c4ccc(C(C)(C)C)cc4)c4ccc(C(C)(C)C)cc4)cc3)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C76H90O4/c1-71(2,3)55-21-29-59(30-22-55)75(63-37-45-67(77)46-38-63,60-31-23-56(24-32-60)72(4,5)6)65-41-49-69(50-42-65)79-53-19-17-15-13-14-16-18-20-54-80-70-51-43-66(44-52-70)76(64-39-47-68(78)48-40-64,61-33-25-57(26-34-61)73(7,8)9)62-35-27-58(28-36-62)74(10,11)12/h21-52,77-78H,13-20,53-54H2,1-12H3 |
| InChIKey | IDYONFVOBPRKDE-UHFFFAOYSA-N |
| XLogP | 19.63 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1067.55 |
| LogP ≤ 5 | 19.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|