C41H52O2 — CID 102215310
5-[4-[bis(4-tert-butylphenyl)-(4-propan-2-ylphenyl)methyl]phenoxy]pentan-1-ol (PubChem CID 102215310) has the molecular formula C41H52O2 and a molecular weight of 576.87 g/mol. Its IUPAC name is 5-[4-[bis(4-tert-butylphenyl)-(4-propan-2-ylphenyl)methyl]phenoxy]pentan-1-ol.
| Compound Name | 5-[4-[bis(4-tert-butylphenyl)-(4-propan-2-ylphenyl)methyl]phenoxy]pentan-1-ol |
|---|---|
| PubChem CID | 102215310 |
| Molecular Formula | C41H52O2 |
| Molecular Weight | 576.87 g/mol |
| Exact Mass | 576.40 |
| IUPAC Name | 5-[4-[bis(4-tert-butylphenyl)-(4-propan-2-ylphenyl)methyl]phenoxy]pentan-1-ol |
| SMILES | CC(C)c1ccc(C(c2ccc(OCCCCCO)cc2)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C41H52O2/c1-30(2)31-12-14-34(15-13-31)41(35-20-16-32(17-21-35)39(3,4)5,36-22-18-33(19-23-36)40(6,7)8)37-24-26-38(27-25-37)43-29-11-9-10-28-42/h12-27,30,42H,9-11,28-29H2,1-8H3 |
| InChIKey | VSJCDIWMKKHBPN-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.87 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|