C43H55IO — CID 132534710
1-[bis(4-tert-butylphenyl)-[4-(6-iodohexoxy)phenyl]methyl]-4-tert-butylbenzene (PubChem CID 132534710) has the molecular formula C43H55IO and a molecular weight of 714.82 g/mol. Its IUPAC name is 1-[bis(4-tert-butylphenyl)-[4-(6-iodohexoxy)phenyl]methyl]-4-tert-butylbenzene.
| Compound Name | 1-[bis(4-tert-butylphenyl)-[4-(6-iodohexoxy)phenyl]methyl]-4-tert-butylbenzene |
|---|---|
| PubChem CID | 132534710 |
| Molecular Formula | C43H55IO |
| Molecular Weight | 714.82 g/mol |
| Exact Mass | 714.33 |
| IUPAC Name | 1-[bis(4-tert-butylphenyl)-[4-(6-iodohexoxy)phenyl]methyl]-4-tert-butylbenzene |
| SMILES | CC(C)(C)c1ccc(C(c2ccc(OCCCCCCI)cc2)(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C43H55IO/c1-40(2,3)32-14-20-35(21-15-32)43(36-22-16-33(17-23-36)41(4,5)6,37-24-18-34(19-25-37)42(7,8)9)38-26-28-39(29-27-38)45-31-13-11-10-12-30-44/h14-29H,10-13,30-31H2,1-9H3 |
| InChIKey | OVOJQJMXHJZQSC-UHFFFAOYSA-N |
| XLogP | 12.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.82 |
| LogP ≤ 5 | 12.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|