About 3-tert-butylphenol;4-tetradecoxyphenol
3-tert-butylphenol;4-tetradecoxyphenol (PubChem CID 70365154) has the molecular formula C30H48O3
and a molecular weight of 456.71 g/mol. Its IUPAC name is 3-tert-butylphenol;4-tetradecoxyphenol.
Molecular Properties
| Compound Name | 3-tert-butylphenol;4-tetradecoxyphenol |
| PubChem CID | 70365154 |
| Molecular Formula | C30H48O3 |
| Molecular Weight | 456.71 g/mol |
| Exact Mass | 456.36 |
| IUPAC Name | 3-tert-butylphenol;4-tetradecoxyphenol |
| SMILES | CC(C)(C)c1cccc(O)c1.CCCCCCCCCCCCCCOc1ccc(O)cc1 |
| InChI | InChI=1S/C20H34O2.C10H14O/c1-2-3-4-5-6-7-8-9-10-11-12-13-18-22-20-16-14-19(21)15-17-20;1-10(2,3)8-5-4-6-9(11)7-8/h14-17,21H,2-13,18H2,1H3;4-7,11H,1-3H3 |
| InChIKey | GKLRFHGRYFAUFL-UHFFFAOYSA-N |
| XLogP | 9.16 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.71 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butylphenol;4-tetradecoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butylphenol;4-tetradecoxyphenol?
The IUPAC name of 3-tert-butylphenol;4-tetradecoxyphenol (CID 70365154) is 3-tert-butylphenol;4-tetradecoxyphenol.
What is the SMILES notation for 3-tert-butylphenol;4-tetradecoxyphenol?
The canonical SMILES for 3-tert-butylphenol;4-tetradecoxyphenol is CC(C)(C)c1cccc(O)c1.CCCCCCCCCCCCCCOc1ccc(O)cc1.
What is the InChIKey of 3-tert-butylphenol;4-tetradecoxyphenol?
The InChIKey is GKLRFHGRYFAUFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34O2.C10H14O/c1-2-3-4-5-6-7-8-9-10-11-12-13-18-22-20-16-14-19(21)15-17-20;1-10(2,3)8-5-4-6-9(11)7-8/h14-17,21H,2-13,18H2,1H3;4-7,11H,1-3H3.
What are the key properties of 3-tert-butylphenol;4-tetradecoxyphenol?
3-tert-butylphenol;4-tetradecoxyphenol has a molecular weight of 456.71 g/mol, XLogP of 9.16, 14 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butylphenol;4-tetradecoxyphenol is sourced from PubChem (CID 70365154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).