About formic acid;3-hexoxyphenol
formic acid;3-hexoxyphenol (PubChem CID 174800460) has the molecular formula C13H20O4
and a molecular weight of 240.30 g/mol. Its IUPAC name is formic acid;3-hexoxyphenol.
Molecular Properties
| Compound Name | formic acid;3-hexoxyphenol |
| PubChem CID | 174800460 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | formic acid;3-hexoxyphenol |
| SMILES | CCCCCCOc1cccc(O)c1.O=CO |
| InChI | InChI=1S/C12H18O2.CH2O2/c1-2-3-4-5-9-14-12-8-6-7-11(13)10-12;2-1-3/h6-8,10,13H,2-5,9H2,1H3;1H,(H,2,3) |
| InChIKey | DWDPVQJNCCDQIF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formic acid;3-hexoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formic acid;3-hexoxyphenol?
The IUPAC name of formic acid;3-hexoxyphenol (CID 174800460) is formic acid;3-hexoxyphenol.
What is the SMILES notation for formic acid;3-hexoxyphenol?
The canonical SMILES for formic acid;3-hexoxyphenol is CCCCCCOc1cccc(O)c1.O=CO.
What is the InChIKey of formic acid;3-hexoxyphenol?
The InChIKey is DWDPVQJNCCDQIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2.CH2O2/c1-2-3-4-5-9-14-12-8-6-7-11(13)10-12;2-1-3/h6-8,10,13H,2-5,9H2,1H3;1H,(H,2,3).
What are the key properties of formic acid;3-hexoxyphenol?
formic acid;3-hexoxyphenol has a molecular weight of 240.30 g/mol, XLogP of 3.05, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formic acid;3-hexoxyphenol is sourced from PubChem (CID 174800460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).