About 3-butoxybenzaldehyde;3-hydroxybenzaldehyde
3-butoxybenzaldehyde;3-hydroxybenzaldehyde (PubChem CID 157058924) has the molecular formula C18H20O4
and a molecular weight of 300.35 g/mol. Its IUPAC name is 3-butoxybenzaldehyde;3-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | 3-butoxybenzaldehyde;3-hydroxybenzaldehyde |
| PubChem CID | 157058924 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-butoxybenzaldehyde;3-hydroxybenzaldehyde |
| SMILES | CCCCOc1cccc(C=O)c1.O=Cc1cccc(O)c1 |
| InChI | InChI=1S/C11H14O2.C7H6O2/c1-2-3-7-13-11-6-4-5-10(8-11)9-12;8-5-6-2-1-3-7(9)4-6/h4-6,8-9H,2-3,7H2,1H3;1-5,9H |
| InChIKey | ABBZKLNPMMGNLB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxybenzaldehyde;3-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxybenzaldehyde;3-hydroxybenzaldehyde?
The IUPAC name of 3-butoxybenzaldehyde;3-hydroxybenzaldehyde (CID 157058924) is 3-butoxybenzaldehyde;3-hydroxybenzaldehyde.
What is the SMILES notation for 3-butoxybenzaldehyde;3-hydroxybenzaldehyde?
The canonical SMILES for 3-butoxybenzaldehyde;3-hydroxybenzaldehyde is CCCCOc1cccc(C=O)c1.O=Cc1cccc(O)c1.
What is the InChIKey of 3-butoxybenzaldehyde;3-hydroxybenzaldehyde?
The InChIKey is ABBZKLNPMMGNLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2.C7H6O2/c1-2-3-7-13-11-6-4-5-10(8-11)9-12;8-5-6-2-1-3-7(9)4-6/h4-6,8-9H,2-3,7H2,1H3;1-5,9H.
What are the key properties of 3-butoxybenzaldehyde;3-hydroxybenzaldehyde?
3-butoxybenzaldehyde;3-hydroxybenzaldehyde has a molecular weight of 300.35 g/mol, XLogP of 3.88, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxybenzaldehyde;3-hydroxybenzaldehyde is sourced from PubChem (CID 157058924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).