C23H22O7S — CID 172780385
[4-[2-(3-formylphenoxy)ethyl]phenyl]methanesulfonic acid;3-hydroxybenzaldehyde (PubChem CID 172780385) has the molecular formula C23H22O7S and a molecular weight of 442.49 g/mol. Its IUPAC name is [4-[2-(3-formylphenoxy)ethyl]phenyl]methanesulfonic acid;3-hydroxybenzaldehyde.
| Compound Name | [4-[2-(3-formylphenoxy)ethyl]phenyl]methanesulfonic acid;3-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 172780385 |
| Molecular Formula | C23H22O7S |
| Molecular Weight | 442.49 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | [4-[2-(3-formylphenoxy)ethyl]phenyl]methanesulfonic acid;3-hydroxybenzaldehyde |
| SMILES | O=Cc1cccc(O)c1.O=Cc1cccc(OCCc2ccc(CS(=O)(=O)O)cc2)c1 |
| InChI | InChI=1S/C16H16O5S.C7H6O2/c17-11-15-2-1-3-16(10-15)21-9-8-13-4-6-14(7-5-13)12-22(18,19)20;8-5-6-2-1-3-7(9)4-6/h1-7,10-11H,8-9,12H2,(H,18,19,20);1-5,9H |
| InChIKey | OEFCODYREKKEQO-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 117.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|