C26H37ClO4 — CID 158545964
1-chloro-3,3-dimethylbutane;3-(3,3-dimethylbutoxy)benzaldehyde;3-hydroxybenzaldehyde (PubChem CID 158545964) has the molecular formula C26H37ClO4 and a molecular weight of 449.03 g/mol. Its IUPAC name is 1-chloro-3,3-dimethylbutane;3-(3,3-dimethylbutoxy)benzaldehyde;3-hydroxybenzaldehyde.
| Compound Name | 1-chloro-3,3-dimethylbutane;3-(3,3-dimethylbutoxy)benzaldehyde;3-hydroxybenzaldehyde |
|---|---|
| PubChem CID | 158545964 |
| Molecular Formula | C26H37ClO4 |
| Molecular Weight | 449.03 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 1-chloro-3,3-dimethylbutane;3-(3,3-dimethylbutoxy)benzaldehyde;3-hydroxybenzaldehyde |
| SMILES | CC(C)(C)CCCl.CC(C)(C)CCOc1cccc(C=O)c1.O=Cc1cccc(O)c1 |
| InChI | InChI=1S/C13H18O2.C7H6O2.C6H13Cl/c1-13(2,3)7-8-15-12-6-4-5-11(9-12)10-14;8-5-6-2-1-3-7(9)4-6;1-6(2,3)4-5-7/h4-6,9-10H,7-8H2,1-3H3;1-5,9H;4-5H2,1-3H3 |
| InChIKey | HPCOPDBSVMXMER-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.03 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|