C18H30O2 — CID 69310955
1,3-bis(3,3-dimethylbutoxy)benzene (PubChem CID 69310955) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 1,3-bis(3,3-dimethylbutoxy)benzene.
| Compound Name | 1,3-bis(3,3-dimethylbutoxy)benzene |
|---|---|
| PubChem CID | 69310955 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 1,3-bis(3,3-dimethylbutoxy)benzene |
| SMILES | CC(C)(C)CCOc1cccc(OCCC(C)(C)C)c1 |
| InChI | InChI=1S/C18H30O2/c1-17(2,3)10-12-19-15-8-7-9-16(14-15)20-13-11-18(4,5)6/h7-9,14H,10-13H2,1-6H3 |
| InChIKey | WUJFYQRYKPHKDU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |