C13H20N2O2 — CID 109374361
3-(3,3-dimethylbutoxy)-N'-hydroxybenzenecarboximidamide (PubChem CID 109374361) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 3-(3,3-dimethylbutoxy)-N'-hydroxybenzenecarboximidamide.
| Compound Name | 3-(3,3-dimethylbutoxy)-N'-hydroxybenzenecarboximidamide |
|---|---|
| PubChem CID | 109374361 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 3-(3,3-dimethylbutoxy)-N'-hydroxybenzenecarboximidamide |
| SMILES | CC(C)(C)CCOc1cccc(/C(N)=N/O)c1 |
| InChI | InChI=1S/C13H20N2O2/c1-13(2,3)7-8-17-11-6-4-5-10(9-11)12(14)15-16/h4-6,9,16H,7-8H2,1-3H3,(H2,14,15) |
| InChIKey | YRFIWJFAJJLMQS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|