C26H38O4 — CID 20738671
1-(2,2-dimethylbutoxy)-3-[2-[3-(2,2-dimethylbutoxy)phenoxy]ethoxy]benzene (PubChem CID 20738671) has the molecular formula C26H38O4 and a molecular weight of 414.59 g/mol. Its IUPAC name is 1-(2,2-dimethylbutoxy)-3-[2-[3-(2,2-dimethylbutoxy)phenoxy]ethoxy]benzene.
| Compound Name | 1-(2,2-dimethylbutoxy)-3-[2-[3-(2,2-dimethylbutoxy)phenoxy]ethoxy]benzene |
|---|---|
| PubChem CID | 20738671 |
| Molecular Formula | C26H38O4 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.28 |
| IUPAC Name | 1-(2,2-dimethylbutoxy)-3-[2-[3-(2,2-dimethylbutoxy)phenoxy]ethoxy]benzene |
| SMILES | CCC(C)(C)COc1cccc(OCCOc2cccc(OCC(C)(C)CC)c2)c1 |
| InChI | InChI=1S/C26H38O4/c1-7-25(3,4)19-29-23-13-9-11-21(17-23)27-15-16-28-22-12-10-14-24(18-22)30-20-26(5,6)8-2/h9-14,17-18H,7-8,15-16,19-20H2,1-6H3 |
| InChIKey | XZTWKRUDPWVKOS-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|