C14H22INO3 — CID 170001651
3-[[3-(2-aminoethoxy)phenoxy]methyl]pentan-3-yl hypoiodite (PubChem CID 170001651) has the molecular formula C14H22INO3 and a molecular weight of 379.24 g/mol. Its IUPAC name is 3-[[3-(2-aminoethoxy)phenoxy]methyl]pentan-3-yl hypoiodite.
| Compound Name | 3-[[3-(2-aminoethoxy)phenoxy]methyl]pentan-3-yl hypoiodite |
|---|---|
| PubChem CID | 170001651 |
| Molecular Formula | C14H22INO3 |
| Molecular Weight | 379.24 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 3-[[3-(2-aminoethoxy)phenoxy]methyl]pentan-3-yl hypoiodite |
| SMILES | CCC(CC)(COc1cccc(OCCN)c1)OI |
| InChI | InChI=1S/C14H22INO3/c1-3-14(4-2,19-15)11-18-13-7-5-6-12(10-13)17-9-8-16/h5-7,10H,3-4,8-9,11,16H2,1-2H3 |
| InChIKey | AIMULQKCQZABCX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.24 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|