C17H29NO2 — CID 79621302
N-tert-butyl-3-(3-ethoxyphenoxy)-2,2-dimethylpropan-1-amine (PubChem CID 79621302) has the molecular formula C17H29NO2 and a molecular weight of 279.42 g/mol. Its IUPAC name is N-tert-butyl-3-(3-ethoxyphenoxy)-2,2-dimethylpropan-1-amine.
| Compound Name | N-tert-butyl-3-(3-ethoxyphenoxy)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 79621302 |
| Molecular Formula | C17H29NO2 |
| Molecular Weight | 279.42 g/mol |
| Exact Mass | 279.22 |
| IUPAC Name | N-tert-butyl-3-(3-ethoxyphenoxy)-2,2-dimethylpropan-1-amine |
| SMILES | CCOc1cccc(OCC(C)(C)CNC(C)(C)C)c1 |
| InChI | InChI=1S/C17H29NO2/c1-7-19-14-9-8-10-15(11-14)20-13-17(5,6)12-18-16(2,3)4/h8-11,18H,7,12-13H2,1-6H3 |
| InChIKey | HQTUVVGJCNQMCJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.42 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |