C16H25NO2 — CID 79627900
N-[3-(4-ethoxyphenoxy)-2,2-dimethylpropyl]cyclopropanamine (PubChem CID 79627900) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is N-[3-(4-ethoxyphenoxy)-2,2-dimethylpropyl]cyclopropanamine.
| Compound Name | N-[3-(4-ethoxyphenoxy)-2,2-dimethylpropyl]cyclopropanamine |
|---|---|
| PubChem CID | 79627900 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-[3-(4-ethoxyphenoxy)-2,2-dimethylpropyl]cyclopropanamine |
| SMILES | CCOc1ccc(OCC(C)(C)CNC2CC2)cc1 |
| InChI | InChI=1S/C16H25NO2/c1-4-18-14-7-9-15(10-8-14)19-12-16(2,3)11-17-13-5-6-13/h7-10,13,17H,4-6,11-12H2,1-3H3 |
| InChIKey | SIRLOKHWVFZYOW-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |