C16H25NO — CID 79628392
N-[3-(3-ethylphenoxy)-2,2-dimethylpropyl]cyclopropanamine (PubChem CID 79628392) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is N-[3-(3-ethylphenoxy)-2,2-dimethylpropyl]cyclopropanamine.
| Compound Name | N-[3-(3-ethylphenoxy)-2,2-dimethylpropyl]cyclopropanamine |
|---|---|
| PubChem CID | 79628392 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | N-[3-(3-ethylphenoxy)-2,2-dimethylpropyl]cyclopropanamine |
| SMILES | CCc1cccc(OCC(C)(C)CNC2CC2)c1 |
| InChI | InChI=1S/C16H25NO/c1-4-13-6-5-7-15(10-13)18-12-16(2,3)11-17-14-8-9-14/h5-7,10,14,17H,4,8-9,11-12H2,1-3H3 |
| InChIKey | MCFBFZLACUFUKX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |